C20H28N4O — CID 38949413
1,3-bis[[4-(dimethylamino)phenyl]methyl]-1-methylurea (PubChem CID 38949413) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 1,3-bis[[4-(dimethylamino)phenyl]methyl]-1-methylurea.
| Compound Name | 1,3-bis[[4-(dimethylamino)phenyl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 38949413 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 1,3-bis[[4-(dimethylamino)phenyl]methyl]-1-methylurea |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)NCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H28N4O/c1-22(2)18-10-6-16(7-11-18)14-21-20(25)24(5)15-17-8-12-19(13-9-17)23(3)4/h6-13H,14-15H2,1-5H3,(H,21,25) |
| InChIKey | YHWRHANXWAUUTF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|