C11H13F3N2O — CID 62489903
N-[[4-(dimethylamino)phenyl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 62489903) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 62489903 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | CN(C)c1ccc(CNC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3N2O/c1-16(2)9-5-3-8(4-6-9)7-15-10(17)11(12,13)14/h3-6H,7H2,1-2H3,(H,15,17) |
| InChIKey | BOMPEMYMESNBGK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|