C18H20F3N3O — CID 38949105
1-[[4-(dimethylamino)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 38949105) has the molecular formula C18H20F3N3O and a molecular weight of 351.37 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 38949105 |
| Molecular Formula | C18H20F3N3O |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CN(C)c1ccc(CNC(=O)NCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H20F3N3O/c1-24(2)16-8-6-13(7-9-16)11-22-17(25)23-12-14-4-3-5-15(10-14)18(19,20)21/h3-10H,11-12H2,1-2H3,(H2,22,23,25) |
| InChIKey | IHQJDNLQKPGDQM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|