C18H16F6N2O — CID 59913441
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(dimethylamino)benzamide (PubChem CID 59913441) has the molecular formula C18H16F6N2O and a molecular weight of 390.33 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(dimethylamino)benzamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 59913441 |
| Molecular Formula | C18H16F6N2O |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-4-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(C(=O)NCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H16F6N2O/c1-26(2)15-5-3-12(4-6-15)16(27)25-10-11-7-13(17(19,20)21)9-14(8-11)18(22,23)24/h3-9H,10H2,1-2H3,(H,25,27) |
| InChIKey | JSJCBYTYAPIGNW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |