C22H29N3O2 — CID 108542009
4-tert-butyl-N-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]benzamide (PubChem CID 108542009) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108542009 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 4-tert-butyl-N-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]benzamide |
| SMILES | CN(C)c1ccc(C(=O)NCCNC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-22(2,3)18-10-6-16(7-11-18)20(26)23-14-15-24-21(27)17-8-12-19(13-9-17)25(4)5/h6-13H,14-15H2,1-5H3,(H,23,26)(H,24,27) |
| InChIKey | JEQOYACQZGPWNN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|