C18H21N3O4 — CID 108543039
N-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]-3,5-dihydroxybenzamide (PubChem CID 108543039) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]-3,5-dihydroxybenzamide.
| Compound Name | N-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 108543039 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-[2-[[4-(dimethylamino)benzoyl]amino]ethyl]-3,5-dihydroxybenzamide |
| SMILES | CN(C)c1ccc(C(=O)NCCNC(=O)c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C18H21N3O4/c1-21(2)14-5-3-12(4-6-14)17(24)19-7-8-20-18(25)13-9-15(22)11-16(23)10-13/h3-6,9-11,22-23H,7-8H2,1-2H3,(H,19,24)(H,20,25) |
| InChIKey | PTMSRGQQVKUIIK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|