C12H17N3O4 — CID 108575005
N-[2-(dimethylcarbamoylamino)ethyl]-3,5-dihydroxybenzamide (PubChem CID 108575005) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is N-[2-(dimethylcarbamoylamino)ethyl]-3,5-dihydroxybenzamide.
| Compound Name | N-[2-(dimethylcarbamoylamino)ethyl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 108575005 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-[2-(dimethylcarbamoylamino)ethyl]-3,5-dihydroxybenzamide |
| SMILES | CN(C)C(=O)NCCNC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C12H17N3O4/c1-15(2)12(19)14-4-3-13-11(18)8-5-9(16)7-10(17)6-8/h5-7,16-17H,3-4H2,1-2H3,(H,13,18)(H,14,19) |
| InChIKey | ZBLYALWYTDNBKD-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|