C13H20N2O4 — CID 104939248
N-[2-[2-(dimethylamino)ethoxy]ethyl]-3,5-dihydroxybenzamide (PubChem CID 104939248) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethoxy]ethyl]-3,5-dihydroxybenzamide.
| Compound Name | N-[2-[2-(dimethylamino)ethoxy]ethyl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 104939248 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethoxy]ethyl]-3,5-dihydroxybenzamide |
| SMILES | CN(C)CCOCCNC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C13H20N2O4/c1-15(2)4-6-19-5-3-14-13(18)10-7-11(16)9-12(17)8-10/h7-9,16-17H,3-6H2,1-2H3,(H,14,18) |
| InChIKey | ONBRJYQZTWEHSL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|