C11H15NO3 — CID 91715801
N-butyl-3,5-dihydroxybenzamide (PubChem CID 91715801) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-butyl-3,5-dihydroxybenzamide.
| Compound Name | N-butyl-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 91715801 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N-butyl-3,5-dihydroxybenzamide |
| SMILES | CCCCNC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H15NO3/c1-2-3-4-12-11(15)8-5-9(13)7-10(14)6-8/h5-7,13-14H,2-4H2,1H3,(H,12,15) |
| InChIKey | IQXZTOQYWQMRFN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|