C14H20N2O4 — CID 108542562
3,5-dihydroxy-N-[2-(pentanoylamino)ethyl]benzamide (PubChem CID 108542562) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 3,5-dihydroxy-N-[2-(pentanoylamino)ethyl]benzamide.
| Compound Name | 3,5-dihydroxy-N-[2-(pentanoylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 108542562 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 3,5-dihydroxy-N-[2-(pentanoylamino)ethyl]benzamide |
| SMILES | CCCCC(=O)NCCNC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C14H20N2O4/c1-2-3-4-13(19)15-5-6-16-14(20)10-7-11(17)9-12(18)8-10/h7-9,17-18H,2-6H2,1H3,(H,15,19)(H,16,20) |
| InChIKey | MBRAAUSCLZGUJJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|