C18H20N2O4 — CID 108542531
3,5-dihydroxy-N-[2-(3-phenylpropanoylamino)ethyl]benzamide (PubChem CID 108542531) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 3,5-dihydroxy-N-[2-(3-phenylpropanoylamino)ethyl]benzamide.
| Compound Name | 3,5-dihydroxy-N-[2-(3-phenylpropanoylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 108542531 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3,5-dihydroxy-N-[2-(3-phenylpropanoylamino)ethyl]benzamide |
| SMILES | O=C(CCc1ccccc1)NCCNC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C18H20N2O4/c21-15-10-14(11-16(22)12-15)18(24)20-9-8-19-17(23)7-6-13-4-2-1-3-5-13/h1-5,10-12,21-22H,6-9H2,(H,19,23)(H,20,24) |
| InChIKey | MFJLTKHKXRJVAC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|