C26H29NO4 — CID 66689343
3,5-dihydroxy-N-[2-[4-(5-phenylpentoxy)phenyl]ethyl]benzamide (PubChem CID 66689343) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is 3,5-dihydroxy-N-[2-[4-(5-phenylpentoxy)phenyl]ethyl]benzamide.
| Compound Name | 3,5-dihydroxy-N-[2-[4-(5-phenylpentoxy)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 66689343 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 3,5-dihydroxy-N-[2-[4-(5-phenylpentoxy)phenyl]ethyl]benzamide |
| SMILES | O=C(NCCc1ccc(OCCCCCc2ccccc2)cc1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C26H29NO4/c28-23-17-22(18-24(29)19-23)26(30)27-15-14-21-10-12-25(13-11-21)31-16-6-2-5-9-20-7-3-1-4-8-20/h1,3-4,7-8,10-13,17-19,28-29H,2,5-6,9,14-16H2,(H,27,30) |
| InChIKey | PSRLTVMUNUFGAQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|