C26H28N2O5 — CID 69132240
[6-[2-[4-(5-phenylpentoxy)phenyl]ethylcarbamoyl]-2-pyridinyl] hydrogen carbonate (PubChem CID 69132240) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is [6-[2-[4-(5-phenylpentoxy)phenyl]ethylcarbamoyl]-2-pyridinyl] hydrogen carbonate.
| Compound Name | [6-[2-[4-(5-phenylpentoxy)phenyl]ethylcarbamoyl]-2-pyridinyl] hydrogen carbonate |
|---|---|
| PubChem CID | 69132240 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [6-[2-[4-(5-phenylpentoxy)phenyl]ethylcarbamoyl]-2-pyridinyl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cccc(C(=O)NCCc2ccc(OCCCCCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C26H28N2O5/c29-25(23-11-7-12-24(28-23)33-26(30)31)27-18-17-21-13-15-22(16-14-21)32-19-6-2-5-10-20-8-3-1-4-9-20/h1,3-4,7-9,11-16H,2,5-6,10,17-19H2,(H,27,29)(H,30,31) |
| InChIKey | HORTXCLLYJFWHS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|