C29H33NO5 — CID 67485301
3-[[4-[6-(4-phenylmethoxyphenoxy)hexyl]benzoyl]amino]propanoic acid (PubChem CID 67485301) has the molecular formula C29H33NO5 and a molecular weight of 475.59 g/mol. Its IUPAC name is 3-[[4-[6-(4-phenylmethoxyphenoxy)hexyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[6-(4-phenylmethoxyphenoxy)hexyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67485301 |
| Molecular Formula | C29H33NO5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 3-[[4-[6-(4-phenylmethoxyphenoxy)hexyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(CCCCCCOc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H33NO5/c31-28(32)19-20-30-29(33)25-13-11-23(12-14-25)8-4-1-2-7-21-34-26-15-17-27(18-16-26)35-22-24-9-5-3-6-10-24/h3,5-6,9-18H,1-2,4,7-8,19-22H2,(H,30,33)(H,31,32) |
| InChIKey | XYVWPGLVPDPVCM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|