C28H28F3NO4 — CID 67485213
3-[[4-[5-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzoyl]amino]propanoic acid (PubChem CID 67485213) has the molecular formula C28H28F3NO4 and a molecular weight of 499.53 g/mol. Its IUPAC name is 3-[[4-[5-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[5-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67485213 |
| Molecular Formula | C28H28F3NO4 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 3-[[4-[5-[4-[4-(trifluoromethyl)phenyl]phenoxy]pentyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(CCCCCOc2ccc(-c3ccc(C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H28F3NO4/c29-28(30,31)24-13-9-21(10-14-24)22-11-15-25(16-12-22)36-19-3-1-2-4-20-5-7-23(8-6-20)27(35)32-18-17-26(33)34/h5-16H,1-4,17-19H2,(H,32,35)(H,33,34) |
| InChIKey | NOKDCRSZXKWWKB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|