C29H32F3NO4S — CID 67484767
3-[[5-[8-[4-[4-(trifluoromethyl)phenyl]phenoxy]octyl]thiophene-2-carbonyl]amino]propanoic acid (PubChem CID 67484767) has the molecular formula C29H32F3NO4S and a molecular weight of 547.64 g/mol. Its IUPAC name is 3-[[5-[8-[4-[4-(trifluoromethyl)phenyl]phenoxy]octyl]thiophene-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[5-[8-[4-[4-(trifluoromethyl)phenyl]phenoxy]octyl]thiophene-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67484767 |
| Molecular Formula | C29H32F3NO4S |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 3-[[5-[8-[4-[4-(trifluoromethyl)phenyl]phenoxy]octyl]thiophene-2-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(CCCCCCCCOc2ccc(-c3ccc(C(F)(F)F)cc3)cc2)s1 |
| InChI | InChI=1S/C29H32F3NO4S/c30-29(31,32)23-12-8-21(9-13-23)22-10-14-24(15-11-22)37-20-6-4-2-1-3-5-7-25-16-17-26(38-25)28(36)33-19-18-27(34)35/h8-17H,1-7,18-20H2,(H,33,36)(H,34,35) |
| InChIKey | NYWFULUOUYRQKC-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|