C30H37NO3S2 — CID 67484765
3-[[5-[4-[4-(4-tert-butylphenyl)-3,5-dimethylphenyl]sulfanylbutyl]thiophene-2-carbonyl]amino]propanoic acid (PubChem CID 67484765) has the molecular formula C30H37NO3S2 and a molecular weight of 523.76 g/mol. Its IUPAC name is 3-[[5-[4-[4-(4-tert-butylphenyl)-3,5-dimethylphenyl]sulfanylbutyl]thiophene-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[5-[4-[4-(4-tert-butylphenyl)-3,5-dimethylphenyl]sulfanylbutyl]thiophene-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67484765 |
| Molecular Formula | C30H37NO3S2 |
| Molecular Weight | 523.76 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 3-[[5-[4-[4-(4-tert-butylphenyl)-3,5-dimethylphenyl]sulfanylbutyl]thiophene-2-carbonyl]amino]propanoic acid |
| SMILES | Cc1cc(SCCCCc2ccc(C(=O)NCCC(=O)O)s2)cc(C)c1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H37NO3S2/c1-20-18-25(19-21(2)28(20)22-9-11-23(12-10-22)30(3,4)5)35-17-7-6-8-24-13-14-26(36-24)29(34)31-16-15-27(32)33/h9-14,18-19H,6-8,15-17H2,1-5H3,(H,31,34)(H,32,33) |
| InChIKey | QUBRUTPNIHRPGK-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.76 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|