C30H37NO4S — CID 67485629
methyl 3-[[5-[4-[4-(4-tert-butylphenyl)-3-methylphenoxy]butyl]thiophene-2-carbonyl]amino]propanoate (PubChem CID 67485629) has the molecular formula C30H37NO4S and a molecular weight of 507.70 g/mol. Its IUPAC name is methyl 3-[[5-[4-[4-(4-tert-butylphenyl)-3-methylphenoxy]butyl]thiophene-2-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[5-[4-[4-(4-tert-butylphenyl)-3-methylphenoxy]butyl]thiophene-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 67485629 |
| Molecular Formula | C30H37NO4S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | methyl 3-[[5-[4-[4-(4-tert-butylphenyl)-3-methylphenoxy]butyl]thiophene-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1ccc(CCCCOc2ccc(-c3ccc(C(C)(C)C)cc3)c(C)c2)s1 |
| InChI | InChI=1S/C30H37NO4S/c1-21-20-24(13-15-26(21)22-9-11-23(12-10-22)30(2,3)4)35-19-7-6-8-25-14-16-27(36-25)29(33)31-18-17-28(32)34-5/h9-16,20H,6-8,17-19H2,1-5H3,(H,31,33) |
| InChIKey | SZIVEOKOXVGXFE-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|