C23H20F3NO4S2 — CID 162603931
3-[[5-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenoxy]sulfanylthiophene-2-carbonyl]amino]propanoic acid (PubChem CID 162603931) has the molecular formula C23H20F3NO4S2 and a molecular weight of 495.54 g/mol. Its IUPAC name is 3-[[5-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenoxy]sulfanylthiophene-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[5-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenoxy]sulfanylthiophene-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 162603931 |
| Molecular Formula | C23H20F3NO4S2 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | 3-[[5-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenoxy]sulfanylthiophene-2-carbonyl]amino]propanoic acid |
| SMILES | Cc1cc(OSc2ccc(C(=O)NCCC(=O)O)s2)cc(C)c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H20F3NO4S2/c1-13-11-17(12-14(2)21(13)15-3-5-16(6-4-15)23(24,25)26)31-33-20-8-7-18(32-20)22(30)27-10-9-19(28)29/h3-8,11-12H,9-10H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | IOMOZSJCIVKDTR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|