C33H34F3NO4 — CID 16750429
3-[[4-[4-[[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzoyl]amino]propanoic acid (PubChem CID 16750429) has the molecular formula C33H34F3NO4 and a molecular weight of 565.63 g/mol. Its IUPAC name is 3-[[4-[4-[[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[4-[[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 16750429 |
| Molecular Formula | C33H34F3NO4 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 3-[[4-[4-[[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzoyl]amino]propanoic acid |
| SMILES | C=CCC(CC=C)(COc1cc(C)c(-c2ccc(C(F)(F)F)cc2)c(C)c1)c1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C33H34F3NO4/c1-5-16-32(17-6-2,26-11-9-25(10-12-26)31(40)37-18-15-29(38)39)21-41-28-19-22(3)30(23(4)20-28)24-7-13-27(14-8-24)33(34,35)36/h5-14,19-20H,1-2,15-18,21H2,3-4H3,(H,37,40)(H,38,39) |
| InChIKey | UTEBEYLRBKOJNN-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|