C34H36F3NO4 — CID 67486362
methyl 3-[[4-[4-[[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-3,6-dienyl]benzoyl]amino]propanoate (PubChem CID 67486362) has the molecular formula C34H36F3NO4 and a molecular weight of 579.66 g/mol. Its IUPAC name is methyl 3-[[4-[4-[[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-3,6-dienyl]benzoyl]amino]propanoate.
| Compound Name | methyl 3-[[4-[4-[[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-3,6-dienyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 67486362 |
| Molecular Formula | C34H36F3NO4 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | methyl 3-[[4-[4-[[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-3,6-dienyl]benzoyl]amino]propanoate |
| SMILES | C=CCC(=CCCc1ccc(C(=O)NCCC(=O)OC)cc1)COc1cc(C)c(-c2ccc(C(F)(F)F)cc2)c(C)c1 |
| InChI | InChI=1S/C34H36F3NO4/c1-5-7-26(9-6-8-25-10-12-28(13-11-25)33(40)38-19-18-31(39)41-4)22-42-30-20-23(2)32(24(3)21-30)27-14-16-29(17-15-27)34(35,36)37/h5,9-17,20-21H,1,6-8,18-19,22H2,2-4H3,(H,38,40) |
| InChIKey | JUYRIEVWFUNNKF-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|