C32H32F3NO4 — CID 67485766
methyl 3-[[4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-3,6-dienyl]benzoyl]amino]propanoate (PubChem CID 67485766) has the molecular formula C32H32F3NO4 and a molecular weight of 551.61 g/mol. Its IUPAC name is methyl 3-[[4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-3,6-dienyl]benzoyl]amino]propanoate.
| Compound Name | methyl 3-[[4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-3,6-dienyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 67485766 |
| Molecular Formula | C32H32F3NO4 |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | methyl 3-[[4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-3,6-dienyl]benzoyl]amino]propanoate |
| SMILES | C=CCC(=CCCc1ccc(C(=O)NCCC(=O)OC)cc1)COc1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C32H32F3NO4/c1-3-5-24(7-4-6-23-8-10-27(11-9-23)31(38)36-21-20-30(37)39-2)22-40-29-18-14-26(15-19-29)25-12-16-28(17-13-25)32(33,34)35/h3,7-19H,1,4-6,20-22H2,2H3,(H,36,38) |
| InChIKey | HWSSPRXYHZYKDR-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|