C21H27F3NO5PS — CID 23031504
[3-amino-3-methyl-5-[5-[4-[4-(trifluoromethyl)phenoxy]butanoyl]thiophen-2-yl]pentyl]phosphonic acid (PubChem CID 23031504) has the molecular formula C21H27F3NO5PS and a molecular weight of 493.48 g/mol. Its IUPAC name is [3-amino-3-methyl-5-[5-[4-[4-(trifluoromethyl)phenoxy]butanoyl]thiophen-2-yl]pentyl]phosphonic acid.
| Compound Name | [3-amino-3-methyl-5-[5-[4-[4-(trifluoromethyl)phenoxy]butanoyl]thiophen-2-yl]pentyl]phosphonic acid |
|---|---|
| PubChem CID | 23031504 |
| Molecular Formula | C21H27F3NO5PS |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | [3-amino-3-methyl-5-[5-[4-[4-(trifluoromethyl)phenoxy]butanoyl]thiophen-2-yl]pentyl]phosphonic acid |
| SMILES | CC(N)(CCc1ccc(C(=O)CCCOc2ccc(C(F)(F)F)cc2)s1)CCP(=O)(O)O |
| InChI | InChI=1S/C21H27F3NO5PS/c1-20(25,12-14-31(27,28)29)11-10-17-8-9-19(32-17)18(26)3-2-13-30-16-6-4-15(5-7-16)21(22,23)24/h4-9H,2-3,10-14,25H2,1H3,(H2,27,28,29) |
| InChIKey | ZKIUELBXQTVMIR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|