C24H36NO7PS — CID 18448129
[3-amino-3-methyl-5-[5-[5-(3,4,5-trimethoxyphenyl)pentanoyl]thiophen-2-yl]pentyl]phosphonic acid (PubChem CID 18448129) has the molecular formula C24H36NO7PS and a molecular weight of 513.59 g/mol. Its IUPAC name is [3-amino-3-methyl-5-[5-[5-(3,4,5-trimethoxyphenyl)pentanoyl]thiophen-2-yl]pentyl]phosphonic acid.
| Compound Name | [3-amino-3-methyl-5-[5-[5-(3,4,5-trimethoxyphenyl)pentanoyl]thiophen-2-yl]pentyl]phosphonic acid |
|---|---|
| PubChem CID | 18448129 |
| Molecular Formula | C24H36NO7PS |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | [3-amino-3-methyl-5-[5-[5-(3,4,5-trimethoxyphenyl)pentanoyl]thiophen-2-yl]pentyl]phosphonic acid |
| SMILES | COc1cc(CCCCC(=O)c2ccc(CCC(C)(N)CCP(=O)(O)O)s2)cc(OC)c1OC |
| InChI | InChI=1S/C24H36NO7PS/c1-24(25,13-14-33(27,28)29)12-11-18-9-10-22(34-18)19(26)8-6-5-7-17-15-20(30-2)23(32-4)21(16-17)31-3/h9-10,15-16H,5-8,11-14,25H2,1-4H3,(H2,27,28,29) |
| InChIKey | UREPIZOYLCDQAK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|