C22H29NO3S — CID 22279783
5-(3-acetylphenyl)-1-[5-(3-amino-4-hydroxy-3-methylbutyl)thiophen-2-yl]pentan-1-one (PubChem CID 22279783) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is 5-(3-acetylphenyl)-1-[5-(3-amino-4-hydroxy-3-methylbutyl)thiophen-2-yl]pentan-1-one.
| Compound Name | 5-(3-acetylphenyl)-1-[5-(3-amino-4-hydroxy-3-methylbutyl)thiophen-2-yl]pentan-1-one |
|---|---|
| PubChem CID | 22279783 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 5-(3-acetylphenyl)-1-[5-(3-amino-4-hydroxy-3-methylbutyl)thiophen-2-yl]pentan-1-one |
| SMILES | CC(=O)c1cccc(CCCCC(=O)c2ccc(CCC(C)(N)CO)s2)c1 |
| InChI | InChI=1S/C22H29NO3S/c1-16(25)18-8-5-7-17(14-18)6-3-4-9-20(26)21-11-10-19(27-21)12-13-22(2,23)15-24/h5,7-8,10-11,14,24H,3-4,6,9,12-13,15,23H2,1-2H3 |
| InChIKey | SURSMHFREIHVSQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|