C20H26ClNO2S — CID 11485789
1-[5-(3-amino-4-hydroxy-3-methylbutyl)-4-chlorothiophen-2-yl]-5-phenylpentan-1-one (PubChem CID 11485789) has the molecular formula C20H26ClNO2S and a molecular weight of 379.95 g/mol. Its IUPAC name is 1-[5-(3-amino-4-hydroxy-3-methylbutyl)-4-chlorothiophen-2-yl]-5-phenylpentan-1-one.
| Compound Name | 1-[5-(3-amino-4-hydroxy-3-methylbutyl)-4-chlorothiophen-2-yl]-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 11485789 |
| Molecular Formula | C20H26ClNO2S |
| Molecular Weight | 379.95 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1-[5-(3-amino-4-hydroxy-3-methylbutyl)-4-chlorothiophen-2-yl]-5-phenylpentan-1-one |
| SMILES | CC(N)(CO)CCc1sc(C(=O)CCCCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C20H26ClNO2S/c1-20(22,14-23)12-11-18-16(21)13-19(25-18)17(24)10-6-5-9-15-7-3-2-4-8-15/h2-4,7-8,13,23H,5-6,9-12,14,22H2,1H3 |
| InChIKey | CNMDPNBBSLWRKW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.95 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|