C20H29NO2 — CID 66673033
(2R)-2-amino-2-methyl-4-[5-(5-phenylpentyl)furan-2-yl]butan-1-ol (PubChem CID 66673033) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (2R)-2-amino-2-methyl-4-[5-(5-phenylpentyl)furan-2-yl]butan-1-ol.
| Compound Name | (2R)-2-amino-2-methyl-4-[5-(5-phenylpentyl)furan-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 66673033 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (2R)-2-amino-2-methyl-4-[5-(5-phenylpentyl)furan-2-yl]butan-1-ol |
| SMILES | C[C@](N)(CO)CCc1ccc(CCCCCc2ccccc2)o1 |
| InChI | InChI=1S/C20H29NO2/c1-20(21,16-22)15-14-19-13-12-18(23-19)11-7-3-6-10-17-8-4-2-5-9-17/h2,4-5,8-9,12-13,22H,3,6-7,10-11,14-16,21H2,1H3/t20-/m1/s1 |
| InChIKey | AJPNYPKIEGHRPI-HXUWFJFHSA-N |
| XLogP | 3.88 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|