C21H37NO — CID 22618767
2-amino-2-methyl-6-(4-octylphenyl)hexan-1-ol (PubChem CID 22618767) has the molecular formula C21H37NO and a molecular weight of 319.53 g/mol. Its IUPAC name is 2-amino-2-methyl-6-(4-octylphenyl)hexan-1-ol.
| Compound Name | 2-amino-2-methyl-6-(4-octylphenyl)hexan-1-ol |
|---|---|
| PubChem CID | 22618767 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | 2-amino-2-methyl-6-(4-octylphenyl)hexan-1-ol |
| SMILES | CCCCCCCCc1ccc(CCCCC(C)(N)CO)cc1 |
| InChI | InChI=1S/C21H37NO/c1-3-4-5-6-7-8-11-19-13-15-20(16-14-19)12-9-10-17-21(2,22)18-23/h13-16,23H,3-12,17-18,22H2,1-2H3 |
| InChIKey | MNPWBWLPHRZPKR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|