C18H32ClNO2 — CID 45261292
(2R)-2-amino-4-(4-heptoxyphenyl)-2-methylbutan-1-ol;hydrochloride (PubChem CID 45261292) has the molecular formula C18H32ClNO2 and a molecular weight of 329.91 g/mol. Its IUPAC name is (2R)-2-amino-4-(4-heptoxyphenyl)-2-methylbutan-1-ol;hydrochloride.
| Compound Name | (2R)-2-amino-4-(4-heptoxyphenyl)-2-methylbutan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 45261292 |
| Molecular Formula | C18H32ClNO2 |
| Molecular Weight | 329.91 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | (2R)-2-amino-4-(4-heptoxyphenyl)-2-methylbutan-1-ol;hydrochloride |
| SMILES | CCCCCCCOc1ccc(CC[C@@](C)(N)CO)cc1.Cl |
| InChI | InChI=1S/C18H31NO2.ClH/c1-3-4-5-6-7-14-21-17-10-8-16(9-11-17)12-13-18(2,19)15-20;/h8-11,20H,3-7,12-15,19H2,1-2H3;1H/t18-;/m1./s1 |
| InChIKey | WBYIFFLWXVYRIP-GMUIIQOCSA-N |
| XLogP | 4.10 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.91 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|