C20H35NO3 — CID 169450532
2-(dimethylamino)-2-[2-(4-heptoxyphenyl)ethyl]propane-1,3-diol (PubChem CID 169450532) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is 2-(dimethylamino)-2-[2-(4-heptoxyphenyl)ethyl]propane-1,3-diol.
| Compound Name | 2-(dimethylamino)-2-[2-(4-heptoxyphenyl)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 169450532 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | 2-(dimethylamino)-2-[2-(4-heptoxyphenyl)ethyl]propane-1,3-diol |
| SMILES | CCCCCCCOc1ccc(CCC(CO)(CO)N(C)C)cc1 |
| InChI | InChI=1S/C20H35NO3/c1-4-5-6-7-8-15-24-19-11-9-18(10-12-19)13-14-20(16-22,17-23)21(2)3/h9-12,22-23H,4-8,13-17H2,1-3H3 |
| InChIKey | VYLFAPTWTIENRK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|