About 1-nonoxy-4-propylbenzene
1-nonoxy-4-propylbenzene (PubChem CID 118632119) has the molecular formula C18H30O
and a molecular weight of 262.44 g/mol. Its IUPAC name is 1-nonoxy-4-propylbenzene.
Molecular Properties
| Compound Name | 1-nonoxy-4-propylbenzene |
| PubChem CID | 118632119 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 1-nonoxy-4-propylbenzene |
| SMILES | CCCCCCCCCOc1ccc(CCC)cc1 |
| InChI | InChI=1S/C18H30O/c1-3-5-6-7-8-9-10-16-19-18-14-12-17(11-4-2)13-15-18/h12-15H,3-11,16H2,1-2H3 |
| InChIKey | VQEJQCYKCFWVIU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-nonoxy-4-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nonoxy-4-propylbenzene?
The IUPAC name of 1-nonoxy-4-propylbenzene (CID 118632119) is 1-nonoxy-4-propylbenzene.
What is the SMILES notation for 1-nonoxy-4-propylbenzene?
The canonical SMILES for 1-nonoxy-4-propylbenzene is CCCCCCCCCOc1ccc(CCC)cc1.
What is the InChIKey of 1-nonoxy-4-propylbenzene?
The InChIKey is VQEJQCYKCFWVIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O/c1-3-5-6-7-8-9-10-16-19-18-14-12-17(11-4-2)13-15-18/h12-15H,3-11,16H2,1-2H3.
What are the key properties of 1-nonoxy-4-propylbenzene?
1-nonoxy-4-propylbenzene has a molecular weight of 262.44 g/mol, XLogP of 5.77, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nonoxy-4-propylbenzene is sourced from PubChem (CID 118632119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).