C16H26O — CID 167030877
1-butoxy-4-(3,3-dimethylbutyl)benzene (PubChem CID 167030877) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 1-butoxy-4-(3,3-dimethylbutyl)benzene.
| Compound Name | 1-butoxy-4-(3,3-dimethylbutyl)benzene |
|---|---|
| PubChem CID | 167030877 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 1-butoxy-4-(3,3-dimethylbutyl)benzene |
| SMILES | CCCCOc1ccc(CCC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26O/c1-5-6-13-17-15-9-7-14(8-10-15)11-12-16(2,3)4/h7-10H,5-6,11-13H2,1-4H3 |
| InChIKey | GTMPMIMLUBAPRD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|