C17H28O2 — CID 82184926
1-(4-butoxyphenyl)-4,4-dimethylpentan-3-ol (PubChem CID 82184926) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-4,4-dimethylpentan-3-ol.
| Compound Name | 1-(4-butoxyphenyl)-4,4-dimethylpentan-3-ol |
|---|---|
| PubChem CID | 82184926 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 1-(4-butoxyphenyl)-4,4-dimethylpentan-3-ol |
| SMILES | CCCCOc1ccc(CCC(O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H28O2/c1-5-6-13-19-15-10-7-14(8-11-15)9-12-16(18)17(2,3)4/h7-8,10-11,16,18H,5-6,9,12-13H2,1-4H3 |
| InChIKey | UZDBYWNLPGVHRD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|