C18H26O5 — CID 22618800
2-[2-(4-heptoxyphenyl)ethyl]propanedioic acid (PubChem CID 22618800) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is 2-[2-(4-heptoxyphenyl)ethyl]propanedioic acid.
| Compound Name | 2-[2-(4-heptoxyphenyl)ethyl]propanedioic acid |
|---|---|
| PubChem CID | 22618800 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-[2-(4-heptoxyphenyl)ethyl]propanedioic acid |
| SMILES | CCCCCCCOc1ccc(CCC(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C18H26O5/c1-2-3-4-5-6-13-23-15-10-7-14(8-11-15)9-12-16(17(19)20)18(21)22/h7-8,10-11,16H,2-6,9,12-13H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | RGJNHBMHSHGLHC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|