C18H25Br3O3 — CID 58711530
2-(4-octylphenoxy)ethyl 2,2,2-tribromoacetate (PubChem CID 58711530) has the molecular formula C18H25Br3O3 and a molecular weight of 529.11 g/mol. Its IUPAC name is 2-(4-octylphenoxy)ethyl 2,2,2-tribromoacetate.
| Compound Name | 2-(4-octylphenoxy)ethyl 2,2,2-tribromoacetate |
|---|---|
| PubChem CID | 58711530 |
| Molecular Formula | C18H25Br3O3 |
| Molecular Weight | 529.11 g/mol |
| Exact Mass | 525.94 |
| IUPAC Name | 2-(4-octylphenoxy)ethyl 2,2,2-tribromoacetate |
| SMILES | CCCCCCCCc1ccc(OCCOC(=O)C(Br)(Br)Br)cc1 |
| InChI | InChI=1S/C18H25Br3O3/c1-2-3-4-5-6-7-8-15-9-11-16(12-10-15)23-13-14-24-17(22)18(19,20)21/h9-12H,2-8,13-14H2,1H3 |
| InChIKey | JTIATDHPLBXQMS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.11 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|