C31H52O9 — CID 100992588
2-[2-[2-[2-[2-[2-[2-(4-octylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate (PubChem CID 100992588) has the molecular formula C31H52O9 and a molecular weight of 568.75 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-(4-octylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-(4-octylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 100992588 |
| Molecular Formula | C31H52O9 |
| Molecular Weight | 568.75 g/mol |
| Exact Mass | 568.36 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(4-octylphenoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOCCOCCOCCOCCOCCOc1ccc(CCCCCCCC)cc1 |
| InChI | InChI=1S/C31H52O9/c1-3-5-6-7-8-9-10-29-11-13-30(14-12-29)39-27-25-37-23-21-35-19-17-33-15-16-34-18-20-36-22-24-38-26-28-40-31(32)4-2/h4,11-14H,2-3,5-10,15-28H2,1H3 |
| InChIKey | YXGHSRVWZHRLCV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.75 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|