C34H38N2O4 — CID 87610857
6-[4-[5-[4-(4-pentylphenyl)phenyl]-1,3,4-oxadiazol-2-yl]phenoxy]hexyl prop-2-enoate (PubChem CID 87610857) has the molecular formula C34H38N2O4 and a molecular weight of 538.69 g/mol. Its IUPAC name is 6-[4-[5-[4-(4-pentylphenyl)phenyl]-1,3,4-oxadiazol-2-yl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[5-[4-(4-pentylphenyl)phenyl]-1,3,4-oxadiazol-2-yl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 87610857 |
| Molecular Formula | C34H38N2O4 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | 6-[4-[5-[4-(4-pentylphenyl)phenyl]-1,3,4-oxadiazol-2-yl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(-c2nnc(-c3ccc(-c4ccc(CCCCC)cc4)cc3)o2)cc1 |
| InChI | InChI=1S/C34H38N2O4/c1-3-5-8-11-26-12-14-27(15-13-26)28-16-18-29(19-17-28)33-35-36-34(40-33)30-20-22-31(23-21-30)38-24-9-6-7-10-25-39-32(37)4-2/h4,12-23H,2-3,5-11,24-25H2,1H3 |
| InChIKey | HDQBSIOWXXSKQP-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|