C29H30O3 — CID 130373833
2-[4-[(E)-2-[4-(4-butoxyphenyl)phenyl]ethenyl]phenyl]ethyl prop-2-enoate (PubChem CID 130373833) has the molecular formula C29H30O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-(4-butoxyphenyl)phenyl]ethenyl]phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[4-[(E)-2-[4-(4-butoxyphenyl)phenyl]ethenyl]phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 130373833 |
| Molecular Formula | C29H30O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 2-[4-[(E)-2-[4-(4-butoxyphenyl)phenyl]ethenyl]phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(/C=C/c2ccc(-c3ccc(OCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H30O3/c1-3-5-21-31-28-18-16-27(17-19-28)26-14-12-24(13-15-26)7-6-23-8-10-25(11-9-23)20-22-32-29(30)4-2/h4,6-19H,2-3,5,20-22H2,1H3/b7-6+ |
| InChIKey | XHZMBBGROHNIPT-VOTSOKGWSA-N |
| XLogP | 6.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|