About 2-(4-ethenylphenyl)ethyl prop-2-enoate
2-(4-ethenylphenyl)ethyl prop-2-enoate (PubChem CID 163299720) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-(4-ethenylphenyl)ethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-(4-ethenylphenyl)ethyl prop-2-enoate |
| PubChem CID | 163299720 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-(4-ethenylphenyl)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(C=C)cc1 |
| InChI | InChI=1S/C13H14O2/c1-3-11-5-7-12(8-6-11)9-10-15-13(14)4-2/h3-8H,1-2,9-10H2 |
| InChIKey | DFBCBNRONLYCEI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethenylphenyl)ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethenylphenyl)ethyl prop-2-enoate?
The IUPAC name of 2-(4-ethenylphenyl)ethyl prop-2-enoate (CID 163299720) is 2-(4-ethenylphenyl)ethyl prop-2-enoate.
What is the SMILES notation for 2-(4-ethenylphenyl)ethyl prop-2-enoate?
The canonical SMILES for 2-(4-ethenylphenyl)ethyl prop-2-enoate is C=CC(=O)OCCc1ccc(C=C)cc1.
What is the InChIKey of 2-(4-ethenylphenyl)ethyl prop-2-enoate?
The InChIKey is DFBCBNRONLYCEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2/c1-3-11-5-7-12(8-6-11)9-10-15-13(14)4-2/h3-8H,1-2,9-10H2.
What are the key properties of 2-(4-ethenylphenyl)ethyl prop-2-enoate?
2-(4-ethenylphenyl)ethyl prop-2-enoate has a molecular weight of 202.25 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethenylphenyl)ethyl prop-2-enoate is sourced from PubChem (CID 163299720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).