C35H30O4 — CID 134346927
2-[4-[9-[4-(2-prop-2-enoyloxyethyl)phenyl]fluoren-9-yl]phenyl]ethyl prop-2-enoate (PubChem CID 134346927) has the molecular formula C35H30O4 and a molecular weight of 514.62 g/mol. Its IUPAC name is 2-[4-[9-[4-(2-prop-2-enoyloxyethyl)phenyl]fluoren-9-yl]phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[4-[9-[4-(2-prop-2-enoyloxyethyl)phenyl]fluoren-9-yl]phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 134346927 |
| Molecular Formula | C35H30O4 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 2-[4-[9-[4-(2-prop-2-enoyloxyethyl)phenyl]fluoren-9-yl]phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(C2(c3ccc(CCOC(=O)C=C)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C35H30O4/c1-3-33(36)38-23-21-25-13-17-27(18-14-25)35(28-19-15-26(16-20-28)22-24-39-34(37)4-2)31-11-7-5-9-29(31)30-10-6-8-12-32(30)35/h3-20H,1-2,21-24H2 |
| InChIKey | QTYIGYOHMXXQQJ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|