C59H46O6 — CID 163736073
2-[4-[9-[3,5-diphenyl-4-(2-prop-2-enoyloxyethoxy)phenyl]fluoren-9-yl]-2,6-diphenylphenoxy]ethyl prop-2-enoate (PubChem CID 163736073) has the molecular formula C59H46O6 and a molecular weight of 851.01 g/mol. Its IUPAC name is 2-[4-[9-[3,5-diphenyl-4-(2-prop-2-enoyloxyethoxy)phenyl]fluoren-9-yl]-2,6-diphenylphenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[4-[9-[3,5-diphenyl-4-(2-prop-2-enoyloxyethoxy)phenyl]fluoren-9-yl]-2,6-diphenylphenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 163736073 |
| Molecular Formula | C59H46O6 |
| Molecular Weight | 851.01 g/mol |
| Exact Mass | 850.33 |
| IUPAC Name | 2-[4-[9-[3,5-diphenyl-4-(2-prop-2-enoyloxyethoxy)phenyl]fluoren-9-yl]-2,6-diphenylphenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1c(-c2ccccc2)cc(C2(c3cc(-c4ccccc4)c(OCCOC(=O)C=C)c(-c4ccccc4)c3)c3ccccc3-c3ccccc32)cc1-c1ccccc1 |
| InChI | InChI=1S/C59H46O6/c1-3-55(60)62-33-35-64-57-49(41-21-9-5-10-22-41)37-45(38-50(57)42-23-11-6-12-24-42)59(53-31-19-17-29-47(53)48-30-18-20-32-54(48)59)46-39-51(43-25-13-7-14-26-43)58(65-36-34-63-56(61)4-2)52(40-46)44-27-15-8-16-28-44/h3-32,37-40H,1-2,33-36H2 |
| InChIKey | LDSCVXFXFJRMIK-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.01 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|