C39H30O7 — CID 118230441
2-[6'-(2-prop-2-enoyloxyethoxy)spiro[benzo[b]fluorene-11,9'-xanthene]-3'-yl]oxyethyl prop-2-enoate (PubChem CID 118230441) has the molecular formula C39H30O7 and a molecular weight of 610.66 g/mol. Its IUPAC name is 2-[6'-(2-prop-2-enoyloxyethoxy)spiro[benzo[b]fluorene-11,9'-xanthene]-3'-yl]oxyethyl prop-2-enoate.
| Compound Name | 2-[6'-(2-prop-2-enoyloxyethoxy)spiro[benzo[b]fluorene-11,9'-xanthene]-3'-yl]oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 118230441 |
| Molecular Formula | C39H30O7 |
| Molecular Weight | 610.66 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | 2-[6'-(2-prop-2-enoyloxyethoxy)spiro[benzo[b]fluorene-11,9'-xanthene]-3'-yl]oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc2c(c1)Oc1cc(OCCOC(=O)C=C)ccc1C21c2ccccc2-c2cc3ccccc3cc21 |
| InChI | InChI=1S/C39H30O7/c1-3-37(40)44-19-17-42-27-13-15-32-35(23-27)46-36-24-28(43-18-20-45-38(41)4-2)14-16-33(36)39(32)31-12-8-7-11-29(31)30-21-25-9-5-6-10-26(25)22-34(30)39/h3-16,21-24H,1-2,17-20H2 |
| InChIKey | XESGHRLPTSMTLL-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.66 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|