C35H32O6 — CID 144703987
2-[4-[3-[4-(2-prop-2-enoyloxyethoxy)phenyl]-1,2-dihydrocyclopenta[b]naphthalen-3-yl]phenoxy]ethyl prop-2-enoate (PubChem CID 144703987) has the molecular formula C35H32O6 and a molecular weight of 548.64 g/mol. Its IUPAC name is 2-[4-[3-[4-(2-prop-2-enoyloxyethoxy)phenyl]-1,2-dihydrocyclopenta[b]naphthalen-3-yl]phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[4-[3-[4-(2-prop-2-enoyloxyethoxy)phenyl]-1,2-dihydrocyclopenta[b]naphthalen-3-yl]phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 144703987 |
| Molecular Formula | C35H32O6 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 2-[4-[3-[4-(2-prop-2-enoyloxyethoxy)phenyl]-1,2-dihydrocyclopenta[b]naphthalen-3-yl]phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(C2(c3ccc(OCCOC(=O)C=C)cc3)CCc3cc4ccccc4cc32)cc1 |
| InChI | InChI=1S/C35H32O6/c1-3-33(36)40-21-19-38-30-13-9-28(10-14-30)35(18-17-27-23-25-7-5-6-8-26(25)24-32(27)35)29-11-15-31(16-12-29)39-20-22-41-34(37)4-2/h3-16,23-24H,1-2,17-22H2 |
| InChIKey | WLVXJPLKBXWJME-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|