About methane;2-(4-phenylphenoxy)ethyl prop-2-enoate
methane;2-(4-phenylphenoxy)ethyl prop-2-enoate (PubChem CID 159356060) has the molecular formula C19H24O3
and a molecular weight of 300.40 g/mol. Its IUPAC name is methane;2-(4-phenylphenoxy)ethyl prop-2-enoate.
Molecular Properties
| Compound Name | methane;2-(4-phenylphenoxy)ethyl prop-2-enoate |
| PubChem CID | 159356060 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | methane;2-(4-phenylphenoxy)ethyl prop-2-enoate |
| SMILES | C.C.C=CC(=O)OCCOc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H16O3.2CH4/c1-2-17(18)20-13-12-19-16-10-8-15(9-11-16)14-6-4-3-5-7-14;;/h2-11H,1,12-13H2;2*1H4 |
| InChIKey | LHXWZNQFXHUAOY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methane;2-(4-phenylphenoxy)ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-(4-phenylphenoxy)ethyl prop-2-enoate?
The IUPAC name of methane;2-(4-phenylphenoxy)ethyl prop-2-enoate (CID 159356060) is methane;2-(4-phenylphenoxy)ethyl prop-2-enoate.
What is the SMILES notation for methane;2-(4-phenylphenoxy)ethyl prop-2-enoate?
The canonical SMILES for methane;2-(4-phenylphenoxy)ethyl prop-2-enoate is C.C.C=CC(=O)OCCOc1ccc(-c2ccccc2)cc1.
What is the InChIKey of methane;2-(4-phenylphenoxy)ethyl prop-2-enoate?
The InChIKey is LHXWZNQFXHUAOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3.2CH4/c1-2-17(18)20-13-12-19-16-10-8-15(9-11-16)14-6-4-3-5-7-14;;/h2-11H,1,12-13H2;2*1H4.
What are the key properties of methane;2-(4-phenylphenoxy)ethyl prop-2-enoate?
methane;2-(4-phenylphenoxy)ethyl prop-2-enoate has a molecular weight of 300.40 g/mol, XLogP of 4.73, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-(4-phenylphenoxy)ethyl prop-2-enoate is sourced from PubChem (CID 159356060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).