C18H18O4 — CID 144554090
3-[4-(4-hydroxyphenyl)phenoxy]propyl prop-2-enoate (PubChem CID 144554090) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-[4-(4-hydroxyphenyl)phenoxy]propyl prop-2-enoate.
| Compound Name | 3-[4-(4-hydroxyphenyl)phenoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 144554090 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-[4-(4-hydroxyphenyl)phenoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C18H18O4/c1-2-18(20)22-13-3-12-21-17-10-6-15(7-11-17)14-4-8-16(19)9-5-14/h2,4-11,19H,1,3,12-13H2 |
| InChIKey | SPHPWVGMUXGLEJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|