About methyl prop-2-enoate;2-phenoxyethyl prop-2-enoate
methyl prop-2-enoate;2-phenoxyethyl prop-2-enoate (PubChem CID 174741391) has the molecular formula C15H18O5
and a molecular weight of 278.30 g/mol. Its IUPAC name is methyl prop-2-enoate;2-phenoxyethyl prop-2-enoate.
Molecular Properties
| Compound Name | methyl prop-2-enoate;2-phenoxyethyl prop-2-enoate |
| PubChem CID | 174741391 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | methyl prop-2-enoate;2-phenoxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OC.C=CC(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C11H12O3.C4H6O2/c1-2-11(12)14-9-8-13-10-6-4-3-5-7-10;1-3-4(5)6-2/h2-7H,1,8-9H2;3H,1H2,2H3 |
| InChIKey | ZDIQWHAOCYDCSF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl prop-2-enoate;2-phenoxyethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl prop-2-enoate;2-phenoxyethyl prop-2-enoate?
The IUPAC name of methyl prop-2-enoate;2-phenoxyethyl prop-2-enoate (CID 174741391) is methyl prop-2-enoate;2-phenoxyethyl prop-2-enoate.
What is the SMILES notation for methyl prop-2-enoate;2-phenoxyethyl prop-2-enoate?
The canonical SMILES for methyl prop-2-enoate;2-phenoxyethyl prop-2-enoate is C=CC(=O)OC.C=CC(=O)OCCOc1ccccc1.
What is the InChIKey of methyl prop-2-enoate;2-phenoxyethyl prop-2-enoate?
The InChIKey is ZDIQWHAOCYDCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3.C4H6O2/c1-2-11(12)14-9-8-13-10-6-4-3-5-7-10;1-3-4(5)6-2/h2-7H,1,8-9H2;3H,1H2,2H3.
What are the key properties of methyl prop-2-enoate;2-phenoxyethyl prop-2-enoate?
methyl prop-2-enoate;2-phenoxyethyl prop-2-enoate has a molecular weight of 278.30 g/mol, XLogP of 2.14, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl prop-2-enoate;2-phenoxyethyl prop-2-enoate is sourced from PubChem (CID 174741391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).