C37H42O9 — CID 145475606
2-[4-[1,1-bis[4-(2-prop-2-enoyloxyethoxy)phenyl]ethyl]phenoxy]ethyl prop-2-enoate;ethane (PubChem CID 145475606) has the molecular formula C37H42O9 and a molecular weight of 630.73 g/mol. Its IUPAC name is 2-[4-[1,1-bis[4-(2-prop-2-enoyloxyethoxy)phenyl]ethyl]phenoxy]ethyl prop-2-enoate;ethane.
| Compound Name | 2-[4-[1,1-bis[4-(2-prop-2-enoyloxyethoxy)phenyl]ethyl]phenoxy]ethyl prop-2-enoate;ethane |
|---|---|
| PubChem CID | 145475606 |
| Molecular Formula | C37H42O9 |
| Molecular Weight | 630.73 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | 2-[4-[1,1-bis[4-(2-prop-2-enoyloxyethoxy)phenyl]ethyl]phenoxy]ethyl prop-2-enoate;ethane |
| SMILES | C=CC(=O)OCCOc1ccc(C(C)(c2ccc(OCCOC(=O)C=C)cc2)c2ccc(OCCOC(=O)C=C)cc2)cc1.CC |
| InChI | InChI=1S/C35H36O9.C2H6/c1-5-32(36)42-23-20-39-29-14-8-26(9-15-29)35(4,27-10-16-30(17-11-27)40-21-24-43-33(37)6-2)28-12-18-31(19-13-28)41-22-25-44-34(38)7-3;1-2/h5-19H,1-3,20-25H2,4H3;1-2H3 |
| InChIKey | BAEIUPJWSSATOW-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.73 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|