C31H40O8 — CID 158911579
2-[3-[4-[2-[4-[3-(2-prop-2-enoyloxyethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propoxy]ethyl prop-2-enoate (PubChem CID 158911579) has the molecular formula C31H40O8 and a molecular weight of 540.65 g/mol. Its IUPAC name is 2-[3-[4-[2-[4-[3-(2-prop-2-enoyloxyethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propoxy]ethyl prop-2-enoate.
| Compound Name | 2-[3-[4-[2-[4-[3-(2-prop-2-enoyloxyethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 158911579 |
| Molecular Formula | C31H40O8 |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 2-[3-[4-[2-[4-[3-(2-prop-2-enoyloxyethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCCOc1ccc(C(C)(C)c2ccc(OCCCOCCOC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C31H40O8/c1-5-29(32)38-23-21-34-17-7-19-36-27-13-9-25(10-14-27)31(3,4)26-11-15-28(16-12-26)37-20-8-18-35-22-24-39-30(33)6-2/h5-6,9-16H,1-2,7-8,17-24H2,3-4H3 |
| InChIKey | JGSHPLWXMGLYKK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|