C33H44O8 — CID 57128581
3-[3-[4-[2-[4-[3-(3-prop-2-enoyloxypropoxy)propoxy]phenyl]propan-2-yl]phenoxy]propoxy]propyl prop-2-enoate (PubChem CID 57128581) has the molecular formula C33H44O8 and a molecular weight of 568.71 g/mol. Its IUPAC name is 3-[3-[4-[2-[4-[3-(3-prop-2-enoyloxypropoxy)propoxy]phenyl]propan-2-yl]phenoxy]propoxy]propyl prop-2-enoate.
| Compound Name | 3-[3-[4-[2-[4-[3-(3-prop-2-enoyloxypropoxy)propoxy]phenyl]propan-2-yl]phenoxy]propoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 57128581 |
| Molecular Formula | C33H44O8 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 3-[3-[4-[2-[4-[3-(3-prop-2-enoyloxypropoxy)propoxy]phenyl]propan-2-yl]phenoxy]propoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOCCCOc1ccc(C(C)(C)c2ccc(OCCCOCCCOC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C33H44O8/c1-5-31(34)40-25-9-21-36-19-7-23-38-29-15-11-27(12-16-29)33(3,4)28-13-17-30(18-14-28)39-24-8-20-37-22-10-26-41-32(35)6-2/h5-6,11-18H,1-2,7-10,19-26H2,3-4H3 |
| InChIKey | NINHSPLZSURCPQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|