C29H40O7 — CID 151210127
2-[2-[4-[2-[4-[2-(2-propoxyethoxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethyl prop-2-enoate (PubChem CID 151210127) has the molecular formula C29H40O7 and a molecular weight of 500.63 g/mol. Its IUPAC name is 2-[2-[4-[2-[4-[2-(2-propoxyethoxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-[4-[2-[4-[2-(2-propoxyethoxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 151210127 |
| Molecular Formula | C29H40O7 |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 2-[2-[4-[2-[4-[2-(2-propoxyethoxy)ethoxy]phenyl]propan-2-yl]phenoxy]ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOc1ccc(C(C)(C)c2ccc(OCCOCCOCCC)cc2)cc1 |
| InChI | InChI=1S/C29H40O7/c1-5-15-31-16-17-32-18-21-34-26-11-7-24(8-12-26)29(3,4)25-9-13-27(14-10-25)35-22-19-33-20-23-36-28(30)6-2/h6-14H,2,5,15-23H2,1,3-4H3 |
| InChIKey | NKCFGASGVQGLTG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|